What is the molar mass of a gas if it takes 7.3 min to effuse through a small hole and 6.0 min for the same amount of N2 to effuse through the same hole gas

The ranking of the bonds from strongest to weakest is: bond between atoms in a metal, bond between sodium and chloride in NaCl, bond between hydrogen and oxygen in water, and the van der Waals bond between adjacent hydrogen atoms. The bond energies for each bond are different, with the bond between atoms in a metal having the highest bond energy, followed by the bond between sodium and chloride in NaCl, the bond between hydrogen and oxygen in water, and the van der Waals bond between adjacent hydrogen atoms having the lowest bond energy.

The ranking of the bonds from strongest to weakest is as follows:

The bond energy, also known as bond dissociation energy, is the energy required to break a bond. Here are the bond energies for each bond:

https://brainly.com/question/33441850

#SPJ6

The strongest bond is the bond between atoms in a metal, followed by the bond between sodium and chloride in NaCl. The bond between hydrogen and oxygen in water is weaker than the previous two, and the van der Waals bond between adjacent hydrogen atoms is the weakest. The bond energy is high for the bonds in a metal and NaCl, moderate for the bond in water, and low for the van der Waals bond between hydrogen atoms.

The bonds can be ranked from strongest to weakest as follows:

The bond energy for each bond is:

https://brainly.com/question/30226871

#SPJ6

Answer: It is because tyrosine kinases and BTK have similar solubilities

Explanation:

In column chromatography, components of a mixture are seperated based on their relative solubilities in two non-mixing phases.

In essence, tyrosine kinases and BTK are present in the eluate due to their similar solubility rates that arise from the similar chemical structure both possess (otherwise it would be impossible for the inhibitor meant for Tyrosine kinase to bind and also inhibits BTK)

Thus, the similar solubilities of both groups is the reason they could elute out of the column without being adsorped.

Answer:

Molarity for the solution is 1.48 M

Explanation:

Molarity involves the moles of solute that are contained in 1L of solution. It is a sort of concentration. The most usual.

7.73 by mass involves the mass of solute that are contained in 100 g of solution, so this one of ethylene glycol contains 7.73 g of it.

Let's determine the moles of solute

7.73 g / molar mass of ethylene glycol = moles

7.73 g / 62 g/mol = 0.124 mol

If the mass of solution is 100 g, we can determine the volume with density.

Density = Mass / Volume

Volume = Mass / Density

Volume = 100 g / 1.19 g/mL = 84.03 mL

In conclusion, 0.124 moles are contained in 84.03 mL

Molarity is mol/L, so let's convert the volume in L

84.03 mL . 1L / 1000 mL = 0.08403 L

0.124 mol / 0.08403 L = 1.48 M

Answer:

2.55×10²⁰ atoms of Mo are contained in 40.6 mg

Explanation:

1 atom of Mo has a mass of 1.59×10⁻²² g

So let's think a rule of three for this question.

Firstly, we convert the mass in mg to g

40.6 mg / 1000 = 0.0406 g

In the mass of 1.59×10⁻²² g, there is 1 atom of Mo

In the mass of 0.0406 g there are (0.0406  / 1.59×10⁻²²) = 2.55×10²⁰ atoms

The number of molybdenum atoms in 40.6 milligrams of molybdenum is approximately 2.55 x 10^22.

To calculate the number of molybdenum atoms in 40.6 milligrams of molybdenum, you need to first convert the milligrams to grams, as the given mass of a single molybdenum atom is in grams. So, 40.6 milligrams equals to 0.0406 grams. Next, divide the total mass (0.0406 grams) by the mass of a single atom (1.59×10-22 grams) to find the number of atoms.

This gives us:

0.0406 grams / 1.59×10-22 grams = 2.55 x 1022 atoms.

So, there are approximately 2.55 x 1022 atoms of molybdenum in 40.6 milligrams of molybdenum.

Learn more about atomic mass calculation here:

https://brainly.com/question/32288931

#SPJ3

Answer:

(a) n₂ = 2

(b) n₂ = 5

(c) n₂ = 4

(d) n₂ = 3

(e) n₂ = 6

Explanation:

The Rydberg equation give us the wavelength of the transition between energy levels according to the formula:

1/λ = Rh x ( 1/n₁² - 1/n₂² )

where n₁ is the final state and n₂ is the initial state.

The strategy here, since we are given the wavelength, is to solve for λ, and then by substituting for n₂ combinations find which ones match our question.

λ = 1 / [ Rh x  ( 1/n₁² - 1/n₂² ) ]

Lets express Rh in 1/Angstrom

1.097 x 10 ⁷ / [m x ( 1 m/ 10¹⁰ A) ] = 0.011 / Å

⇒ λ  = 1 / [0.011 A x  ( 1/n₁² - 1/n₂² )] = 911.6 Å / ( 1/n₁² - 1/n₂² )

For n₁ = 2  n₂ = 3, 4, 5,.......

λ  ( n₂ = 3 ) = 911.6 A / ( 1/2² - 1/3² ) = 6563.5 Å

λ  ( n₂ = 4 ) = 911.6 A / ( 1/2² - 1/4² ) = 4861.9  Å

λ  ( n₂ = 5 ) = 911.6 A / ( 1/2² - 1/5² ) = 4341.0  Å

So we have matched three of the transitions

Now for n₁ = 1    n₂ = 2, 3, 4....

λ  ( n₂ = 2 ) = 911.6 A / ( 1/1² - 1/2² ) = 1215.5 Å

For  n₁ = 3          n₂ = 4, 5, 6....

λ  ( n₂ = 4 ) = 911.6 A / ( 1/3² - 1/4² ) = 18752.9 Å

λ ( n₂ = 5 ) =  911.6 A / ( 1/3² - 1/5² ) = 12819.4  Å

λ ( n₂ = 6 ) =  911.6 A / ( 1/3² - 1/6² ) = 10939.2 Å

a. For [tex]\lambda=1212.7\;\rm \r{A}[/tex], initial transition level is 2.

b. For  [tex]\lambda=4340.5\;\rm \r{A}[/tex], initial transition level is 5.

c. For  [tex]\lambda=4861.3\;\rm \r{A}[/tex], initial level of transition is 4.

d. For [tex]\lambda=6562.8\;\rm \r{A}[/tex], initial level of transition is 3.

e. For  [tex]\lambda=10,938\;\rm \r{A}[/tex], the initial level of transition has been 6.

The wavelength from the transition has been given by the Rydberg equation as:

[tex]\dfrac{1}{\lambda}=\text Rh\dfrac{1}{N_1}-\dfrac{1}{N_2}[/tex]

Where, wavelength of the radiation, [tex]\lambda[/tex]

The initial transition level, [tex]N_1[/tex]

The final transition level, [tex]N_2[/tex]

The constant [tex]Rh=1.097\;\times\;10^7[/tex], or in Armstrong it can be given as, [tex]0.011/\r{\rm A}[/tex]

The wavelength can be given as:

[tex]\lambda=\dfrac{1}{0.011\;\r{\rm A}\;\times\;(\frac{1}{N_1^2} -\frac{1}{N_2^2}) }[/tex]

[tex]\rm \lambda=\dfrac{911.6\;\r{A}}{\frac{1}{N_1^2}-\frac{1}{N_2^2} }[/tex]

a. The initial level ([tex]N_2[/tex]) of transition has been given for [tex]\lambda=1212.7\;\rm \r{A}[/tex], and [tex]N_2=2[/tex] has been given, with substituting [tex]N_1=1[/tex]

[tex]\rm \lambda=\dfrac{911.6\;\r{A}}{\frac{1}{1^2}-\frac{1}{2^2} }\\\lambda=1215.5\;\r{A}[/tex]

Thus, for [tex]\lambda=1212.7\;\rm \r{A}[/tex], initial transition level is 2.

b. For, [tex]\lambda=4340.5\;\rm \r{A}[/tex], and [tex]N_2=2[/tex], [tex]N_1=5[/tex]

[tex]\rm \lambda=\dfrac{911.6\;\r{A}}{\frac{1}{2^2}-\frac{1}{5^2} }\\\lambda=4341.0\;\r{A}[/tex]

Thus, for [tex]\lambda=4340.5\;\rm \r{A}[/tex], initial transition level is 5.

c. For, [tex]\lambda=4861.3\;\rm \r{A}[/tex], the final transition has been, [tex]N_2=2[/tex], the initial level has been substituted as [tex]N_1=4[/tex]:

[tex]\rm \lambda=\dfrac{911.6\;\r{A}}{\frac{1}{2^2}-\frac{1}{4^2} }\\\lambda=4861.3\;\r{A}[/tex]

Thus, for [tex]\lambda=4861.3\;\rm \r{A}[/tex], initial level of transition is 4.

d. For [tex]\lambda=6562.8\;\rm \r{A}[/tex], the final level has been 2, the initial level has been substituted as, [tex]N_1=3[/tex]

[tex]\rm \lambda=\dfrac{911.6\;\r{A}}{\frac{1}{2^2}-\frac{1}{3^2} }\\\lambda=6562.8\;\r{A}[/tex]

Thus, for [tex]\lambda=6562.8\;\rm \r{A}[/tex], initial level of transition is 3.

e. For [tex]\lambda=10,938\;\rm \r{A}[/tex], the initial level has been substituted as, [tex]N_1=6[/tex]

[tex]\rm \lambda=\dfrac{911.6\;\r{A}}{\frac{1}{3^2}-\frac{1}{6^2} }\\\lambda=10,938\;\r{A}[/tex]

Thus, for [tex]\lambda=10,938\;\rm \r{A}[/tex], the initial level of transition has been 6.

For more information about transition levels, refer to the link:

https://brainly.com/question/4511550

Answer:

Half life = 79.67 sec

Explanation:

Given that:

k = [tex]8.7\times 10^{-3}\ s^{-1}[/tex]

The expression for half life is shown below as:-

[tex]t_{1/2}=\frac{\ln2}{k}[/tex]

Where, k is rate constant

So,  

[tex]t_{1/2}=\frac{\ln2}{8.7\times 10^{-3}\ s^{-1}}[/tex]

[tex]t_{1/2}=114.94252\ln \left(2\right)\ sec=79.67\ sec[/tex]

Half life = 79.67 sec

Answer: Option A. A candy bar

Option B. stretched rubber band

Option D. A roller coaster at the top of a hill

Explanation:

Answer:

The correct answers are options A. "A candy bar", B. "A stretched rubber band" and D. "A roller coaster at the top of a hill".

Explanation:

Potential energy is defined as the force that any body for its location at a certain position. Three examples of objects having potential energy are a candy bar, a stretched rubber band and a roller coaster at the top of a hill. These three objects are not in motion and its energy is only "potential", rising from the arrangement of its particles, the gravitational force, electric charges, among other factors.

Answer: The empirical formula for the given compound is [tex]CuCl_3[/tex]

Explanation:

We are given:

Mass of copper chloride in 1 L or 1000 mL of solution = 42.62 grams

Taking Trial A:

Volume of solution = 49.6 mL

Applying unitary method:

In 1000 mL of solution, the mass of copper chloride present is 42.62 grams

So, in 49.6 mL of solution, the mass of copper chloride will be = [tex]\frac{42.62}{1000}\times 49.6=2.114g[/tex]

We are given:

Mass of filter paper = 0.908 g

Mass of filter paper + copper = 1.694 g

Mass of copper = [1.694 - 0.908] g = 0.786 g

Mass of chlorine in the sample = [2.114 - 0.786]g = 1.328 g

To formulate the empirical formula, we need to follow some steps:

Moles of Copper =[tex]\frac{\text{Given mass of Copper}}{\text{Molar mass of Copper}}=\frac{0.786g}{63.5g/mole}=0.0124moles[/tex]

Moles of Chlorine = [tex]\frac{\text{Given mass of Chlorine}}{\text{Molar mass of Chlorine}}=\frac{1.328g}{35.5g/mole}=0.0374moles[/tex]

For the mole ratio, we divide each value of the moles by the smallest number of moles calculated which is 0.0124 moles.

For Copper = [tex]\frac{0.0124}{0.0124}=1[/tex]

For Chlorine = [tex]\frac{0.0374}{0.0124}=3.02\approx 3[/tex]

The ratio of Cu : Cl = 1 : 3

Hence, the empirical formula for the given compound is [tex]CuCl_3[/tex]

Based on the experimental data, the empirical formula of the copper chloride is CuCl₂.

To determine the empirical formula of the copper chloride, we'll use the provided experimental data for three trials.

First, calculate the mass of copper produced in each trial:

Next, calculate the moles of copper produced using its molar mass (Cu = 63.55 g/mol):

Now, find the moles of copper chloride (assuming CuCl₂):

1. [tex]\text{Trial A:} & \quad \text{Volume of solution} = 49.6 \, \text{mL}, \\[/tex]

2. [tex]\text{Trial B:} & \quad \text{Volume of solution} = 48.3 \, \text{mL}, \\[/tex]

3. [tex]\text{Trial C:} & \quad \text{Volume of solution} = 42.2 \, \text{mL}, \\[/tex]

Lastly, the moles of chlorine (as Cl2) can be determined as the difference between the moles of Cu and total moles of CuCl₂:

Averaging these values, the ratio of moles of Cu to Cl is approximately 1:2, suggesting an empirical formula of CuCl₂.

Complete Question: -

In a student experiment, the empirical formula of a copper halide was found by adding aluminum metal to an aqueous solution of the halide, displacing copper metal. The copper metal was filtered, washed with distilled water, dried, and weighed. Three separate determinations were performed. The copper halide solution contained 42.62 g of copper chloride per liter. The student recorded the following experimental data:

Trial A:

Trial B:

Trial C:

Write the empirical formula of copper chloride based on the experimental data.

Answer:

The balanced reaction is this:

2 C₄H₁₀ (g)  +  13 O₂(g) →  8 CO₂(g) +  10 H₂O (g)

Explanation:

Combustion is a chemical reaction whose reagents are oxygen, usually in excess and a hydrocarbon to generate carbon dioxide and water in the form of steam, as products.

Butane is considered as a reactant and it is a sort of alkane, in this case with 4 C (prefix but).

O₂ is needed for the complete combustion of butane.

Answer:

pH = 4.543

Explanation:

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

Answer: The speed of the electron is [tex]7.24\times 10^3m/s[/tex]

Explanation:

To calculate the speed of electron for given wavelength, we use the equation given by De-Broglie's, which is:

[tex]\lambda=\frac{h}{mv}[/tex]

where,

[tex]\lambda[/tex] = De-Broglie's wavelength = [tex]100nm=100\times 10^{-9}m[/tex]

h = Planck's constant = [tex]6.6\times 10^{-34}Js[/tex]

m = mass of the electron = [tex]9.11\times 10^{-31}kg[/tex]

v = speed of the electron = ?

Putting values in above equation, we get:

[tex]100\times 10^{-9}m=\frac{6.6\times 10^{-34}Js}{9.11\times 10^{-31}kg\times v}\\\\v=\frac{6.6\times 10^{-34}Js}{9.11\times 10^{-31}kg\times 100\times 10^{-9}m}=7.24\times 10^3m/s[/tex]

Hence, the speed of the electron is [tex]7.24\times 10^3m/s[/tex]

The speed of an electron with a de Broglie wavelength of 100 nm is approximately 7.28 × 105 m/s, calculated by rearranging the de Broglie wavelength formula and using known values for Planck's constant and the electron's mass.

The task here is to calculate the speed of an electron given its de Broglie wavelength. The de Broglie wavelength λ is related to the momentum p of a particle via the equation λ = h / p, where h is Planck's constant (6.62607015 × 10−34 m² kg / s). Momentum can be expressed as p = mv, where m is the mass of the electron (9.11 × 10−31 kg) and v is the velocity we need to find.

Reordering the de Broglie equation to solve for velocity, v = h / (λm), and substituting the given values, we calculate the electron's speed for a de Broglie wavelength of 100 nm (1 × 10−9 meters).

v = λm / h = 6.62607015 × 10−34 / (9.11 × 10−31 × 1 × 10−9)
= 6.62607015 × 10−5 / 9.11
= 7.28 × 105 m/s.

The speed of the electron is approximately 7.28 × 105 meters per second (m/s).

Answer:

Blood agent

Explanation:

chemical warfare agents are of four major types:

nerve, blister, choking and blood agents

Nerve agents - it attacks the central nervous system and can enter the body through inhalation

Blister agents - it attacks skins and it is rapidly absorbed by the skin cells

chocking agents -  as name denoted, it is related to the respiratory system.

Blood agent-  it attacks the circulatory system of the body. it prevents the circulation of blood into the tissue and organs

Answer:

25.0 g of sodium carbonate are present in 220 ml of the solution.

Explanation:

Hi there!

I have found the complete question on the web:

Calculate the volume in milliliters of a 1.07 M sodium carbonate solution that contains 25.0g of sodium carbonate Na2CO3. Be sure your answer has the correct number of significant digits.

First, let's find how many moles of sodium carbonate have a mass of 25.0 g.

The molar mass of Na₂CO₃ is 106 g/mol.

So, if 106 g of sodium carbonate is equal to 1 mol, then 25.0 g will be:

25.0 g · (1 mol / 106 g) = 0.236 mol Na₂CO₃

The solution contains 1.07 mol sodium carbonate in 1 liter.

So, if 1.07 mol sodium carbonate is present in 1 l solution, then, 0.236 mol will be present in:

0.236 mol · (1000 ml / 1.07 mo) = 221 ml (220 ml without any intermediate rounding).

25.0 g of sodium carbonate are present in 220 ml of the solution.

Final answer:

To calculate the volume in milliliters of a sodium carbonate solution, you need to know the concentration of the solution.

Explanation:

To calculate the volume in milliliters of a sodium carbonate solution, we need to know the concentration of the solution. Without that information, we are unable to provide an accurate calculation. Please provide the concentration of the sodium carbonate solution in the question.

Answer: The new water level when silver metal is submerged is 18.24 mL

Explanation:

We are given:

Volume of graduated cylinder = 15.0 mL

To calculate volume of a substance, we use the equation:

[tex]\text{Density of substance}=\frac{\text{Mass of substance}}{\text{Volume of substance}}[/tex]

Density of silver metal = 10.5 g/mL

Mass of silver metal = 34.0 g

Putting values in above equation, we get:

[tex]10.5g/mL=\frac{34.0g}{\text{Volume of silver metal}}\\\\\text{Volume of silver metal}=\frac{34.0g}{10.5g/mL}=3.24mL[/tex]

New water level = Volume of silver metal + Volume of graduated cylinder

New water level = (3.24 + 15.0) mL = 18.24 mL

Hence, the new water level when silver metal is submerged is 18.24 mL

Final answer:

The condensed electron configurations for V³⁺, Ni²⁺, and La³⁺ are [Ar]3d², [Ar]3d⁸, and [Xe] respectively. V³⁺ and Ni²⁺ are paramagnetic with unpaired d electrons, while La³⁺ is not paramagnetic.

Explanation:

To determine the condensed electron configuration of transition metal ions and their magnetic properties, we consider the electron configuration of the neutral atom and then remove electrons corresponding to the ion's charge, starting with the outermost shell.

Answer:

Molality for this solution is 0.31 m

Explanation:

Molality → Mol of solute / kg of solvent

Mass of solute = 1.85 g (CO(NH₂)₂

% by mass, means mass of solute in 100 g of solution

Mass of solution = Mass of solute + Mass of solvent

As 1.85 g is the mass of solute, the mass of solvent would be 98.15 g to complete the 100g of solution.

Let's convert the mass of solvent (g to kg)

1 g = 1×10⁻³ kg

98.2 g .  1×10⁻³ kg / 1g = 0.0982 kg

Let's convert the mass of solute to moles (mass / molar mass)

1.85 g / 60 g/mol = 0.0308 mol

Molality = 0.0308 mol / 0.0982 kg → 0.31 m

To find the molality of the solution, we calculate the number of moles of urea (0.031 mol) and the mass of water (0.10315 kg). The molality is then computed as moles of urea divided by the mass of water, which comes out to be approximately 0.30 m.

To calculate the molality of the solution, we need to first know the number of moles of the solute (urea) and the mass of the solvent (water) in kilograms.

The mass % of the solution is given as 1.85%, meaning that we have 1.85g of urea in 100g of the solution. Considering that the molar mass of urea (CO(NH2)2) is about 60.06 g/mol, the number of moles of urea can be calculated as follows: Moles of urea = mass / molar mass = 1.85g / 60.06 g/mol ≈ 0.031 mol.

Since the density of the solution is given as 1.05 g/mL, the mass of the solution for 100 mL (or 100g since density = mass/volume) would be 100 mL * 1.05 g/mL = 105g. In this 105g of the solution, 1.85g is urea, so the mass of water (solvent) would be 105g - 1.85g = 103.15g or 0.10315 kg (since 1g = 0.001 kg).

Molality is the number of solute's moles divided by the mass of solvent (in kg). Thus, the molality of the solution would be: Molality = moles of urea / mass of water in kg = 0.031 mol / 0.10315 kg ≈ 0.30 mol/kg or 0.30 m.

For more such question on molality visit:

https://brainly.com/question/13200956

#SPJ3

Answer:

The incorrect statement is a.

Explanation:

[tex]2SO_3(g)\rightarrow 2SO_2(g)+O_2(g)[/tex] ΔH° = 198 kJ

Endothermic reactions are defined as the reactions in which energy is absorbed by the chemical reaction.The enthalpy of the reaction [tex](\Delta H)[/tex] positive.

This can be also understood as the reactions in which the energy of products is more than the energy of the reactants.

In the given thermochemical equation,enthalpy of the products exceeds that of the reactants

The incorrect statement regarding the thermochemical equation 2SO₃(g) → 2SO₂(g) + O₂(g); ΔH° = 198 kJ is that the enthalpy of the reactants exceeds that of the products, which is falls under an endothermic reaction. Therefore the option a is incorrect for this reaction.

The question revolves around the correctness of statements related to a given thermochemical equation: 2SO₃(g) → 2SO₂(g) + O₂(g); ΔH° = 198 kJ. The incorrect statement is:

The enthalpy of the reactants exceeds that of the products.

Since the ΔH° is positive (198 kJ), it indicates that the reaction is endothermic. This means energy is absorbed, thus the enthalpy of the products exceeds that of the reactants, making option (a) incorrect. Conversely, for the reverse reaction (2SO₂(g) + O₂(g) → 2SO₃(g)), ΔH° would indeed be – 198 kJ, illustrating that the reaction is exothermic in the reverse direction, as more energy is released than absorbed.

Options b and c are correct as they accurately describe the thermodynamics of the reaction and its reverse. The statement about external pressure (d) is not directly related to thermochemical equations but generally assumes standard conditions unless otherwise specified. Lastly, option e correctly divides the total heat absorbed by the number of moles of SO₃(g) consumed to arrive at the amount of heat consumed per mole. Therefore, the incorrect statement concerns the comparison of enthalpy between reactants and products.

Electromagnetic radiation can be arranged by wavelength, frequency, or energy. In increasing order, by wavelength, it is: X-ray, Ultraviolet, Visible, Infrared, Microwave, Radio waves. In increasing order, by frequency and energy, it is: Radio waves, Microwave, Infrared, Visible, Ultraviolet, X-ray.

The types of electromagnetic radiation listed can be arranged by wavelength, frequency, and energy. The relationship among these three properties is that as wavelength increases, frequency and energy decrease, and vice versa.

https://brainly.com/question/2334706

#SPJ6

Answer:

For 1: Nitrogen and hydrogen atoms are unbalanced.

For 2: Hydrogen atom is balanced and oxygen atom is unbalanced.

For 3: Carbon atom is balanced and oxygen and hydrogen atom is unbalanced.

Explanation:

The given chemical equation follows:

[tex]N_2+H_2\rightarrow NH_3[/tex]

On the reactant side:

Number of nitrogen atoms = 2

Number of hydrogen atoms = 2

On the product side:

Number of nitrogen atoms = 1

Number of hydrogen atoms = 3

As, the number of nitrogen and hydrogen atoms are not same on both the sides of the reaction. So, these elements are unbalanced.

The given chemical equation follows:

[tex]H_2O\rightarrow H_2+O_2[/tex]

On the reactant side:

Number of oxygen atoms = 1

Number of hydrogen atoms = 2

On the product side:

Number of oxygen atoms = 1

Number of hydrogen atoms = 3

As, the number of oxygen atoms are not same on both the sides of the reaction. So, this element is unbalanced.

Number of hydrogen atoms are same on both the sides of the reaction. So, this element is balanced.

The given chemical equation follows:

[tex]CH_4+O_2\rightarrow CO_2+H_2O[/tex]

On the reactant side:

Number of carbon atoms = 1

Number of oxygen atoms = 2

Number of hydrogen atoms = 4

On the product side:

Number of carbon atoms = 1

Number of oxygen atoms = 3

Number of hydrogen atoms = 2

As, the number of oxygen and hydrogen atoms are not same on both the sides of the reaction. So, these element are unbalanced.

Number of carbon atoms are same on both the sides of the reaction. So, this element is balanced.

Nitrogen and hydrogen atoms are unbalanced in first reaction. Hydrogen atom is balanced and oxygen atom is unbalanced in second reaction. Carbon atom is balanced and oxygen and hydrogen atom is unbalanced for third reaction.

A balanced reaction is a chemical equation in which the number of atoms of each element on both sides of the equation is the same.

[tex]\rm N_2 + H_2 \rightarrow NH_3[/tex]

On the reactant side:

Number of nitrogen atoms = 2

Number of hydrogen atoms = 2

On the product side:

Number of nitrogen atoms = 1

Number of hydrogen atoms = 3

Because the number of nitrogen and hydrogen atoms on both sides of the reaction is not the same. As a result, these elements are imbalanced.

[tex]\rm H_2O \rightarrow H_2 + O_2[/tex]

On the reactant side:

Number of oxygen atoms = 1

Number of hydrogen atoms = 2

On the product side:

Number of oxygen atoms = 1

Number of hydrogen atoms = 3

Because the number of oxygen atoms on both sides of the reaction is not the same. As a result, this element is imbalanced. The number of hydrogen atoms on both sides of the reaction is the same. As a result, this element is balanced.

[tex]\rm CH_4 + O_2 \rightarrow CO_2 + H_2O[/tex]

On the reactant side:

Number of carbon atoms = 1

Number of oxygen atoms = 2

Number of hydrogen atoms = 4

On the product side:

Number of carbon atoms = 1

Number of oxygen atoms = 3

Number of hydrogen atoms = 2

Because the number of oxygen and hydrogen atoms on both sides of the reaction is not the same. As a result, these elements are imbalanced. The number of carbon atoms on both sides of the reaction is the same. As a result, this element is balanced.

To know more about balanced and unbalanced reaction, here:

https://brainly.com/question/14258973

#SPJ3

a) The molality of the 1.22 M sugar solution is approximately [tex]\(1.089 \, \text{mol/kg}\).[/tex]

b) The molality of the 0.87 M NaOH solution is approximately [tex]\(0.8365 \, \text{mol/kg}\).[/tex]

c) The molality of the 5.24 M NaHCO3 solution is approximately [tex]\(4.4034 \, \text{mol/kg}\).[/tex]

(a) 1.22 M sugar (C12H22O11) solution:

Given:

- Molarity (\(M\)) of sugar solution = 1.22 M

- Density of solution = 1.12 g/ml

We'll assume that the density given is for the solution and not just for water.

1. Calculate the mass of 1 L (1000 ml) of solution:

[tex]\[ \text{mass of solution} = \text{density} \times \text{volume} \][/tex]

[tex]\[ \text{mass of solution} = 1.12 \, \text{g/ml} \times 1000 \, \text{ml} \][/tex]

[tex]\[ \text{mass of solution} = 1120 \, \text{g} \][/tex]

2. Convert the mass of the solution to kilograms:

[tex]\[ \text{mass of solution in kg} = \frac{{1120 \, \text{g}}}{{1000}} = 1.12 \, \text{kg} \][/tex]

3. Calculate the moles of sugar (C12H22O11):

[tex]\[ \text{moles of sugar} = \text{Molarity} \times \text{volume in L} \][/tex]

[tex]\[ \text{moles of sugar} = 1.22 \, \text{mol/L} \times 1 \, \text{L} = 1.22 \, \text{mol} \][/tex]

4. Calculate the molality ([tex]\(m\)[/tex]):

[tex]\[ m = \frac{{\text{moles of sugar}}}{{\text{mass of solvent in kg}}} \][/tex]

Let's perform the calculation.

For the 1.22 M sugar solution:

1. Calculate the mass of 1 L (1000 ml) of solution:

[tex]\[ \text{mass of solution} = \text{density} \times \text{volume} \][/tex]

[tex]\[ \text{mass of solution} = 1.12 \, \text{g/ml} \times 1000 \, \text{ml} \][/tex]

[tex]\[ \text{mass of solution} = 1120 \, \text{g} \][/tex]

2. Convert the mass of the solution to kilograms:

[tex]\[ \text{mass of solution in kg} = \frac{{1120 \, \text{g}}}{{1000}} = 1.12 \, \text{kg} \][/tex]

3. Calculate the moles of sugar (C12H22O11):

[tex]\[ \text{moles of sugar} = \text{Molarity} \times \text{volume in L} \][/tex]

[tex]\[ \text{moles of sugar} = 1.22 \, \text{mol/L} \times 1 \, \text{L} = 1.22 \, \text{mol} \][/tex]

4. Calculate the molality ([tex]\(m\)[/tex]):

[tex]\[ m = \frac{{\text{moles of sugar}}}{{\text{mass of solvent in kg}}} \][/tex]

[tex]\[ m = \frac{{1.22 \, \text{mol}}}{{1.12 \, \text{kg}}} \][/tex]

[tex]\[ m \approx 1.089 \, \text{mol/kg} \][/tex]

So, the molality of the 1.22 M sugar solution is approximately [tex]\(1.089 \, \text{mol/kg}\).[/tex]

(b) 0.87 M NaOH solution:

Given:

- Molarity ([tex]\(M\)[/tex]) of NaOH solution = 0.87 M

- Density of solution = 1.04 g/ml

We'll follow the same steps as above to calculate the molality.

Let's calculate for the NaOH solution.

For the 0.87 M NaOH solution:

1. Calculate the mass of 1 L (1000 ml) of solution:

[tex]\[ \text{mass of solution} = \text{density} \times \text{volume} \][/tex]

[tex]\[ \text{mass of solution} = 1.04 \, \text{g/ml} \times 1000 \, \text{ml} \][/tex]

[tex]\[ \text{mass of solution} = 1040 \, \text{g} \][/tex]

2. Convert the mass of the solution to kilograms:

[tex]\[ \text{mass of solution in kg} = \frac{{1040 \, \text{g}}}{{1000}} = 1.04 \, \text{kg} \][/tex]

3. Calculate the moles of NaOH:

[tex]\[ \text{moles of NaOH} = \text{Molarity} \times \text{volume in L} \][/tex]

[tex]\[ \text{moles of NaOH} = 0.87 \, \text{mol/L} \times 1 \, \text{L} = 0.87 \, \text{mol} \][/tex]

4. Calculate the molality (\(m\)):

[tex]\[ m = \frac{{\text{moles of NaOH}}}{{\text{mass of solvent in kg}}} \][/tex]

[tex]\[ m = \frac{{0.87 \, \text{mol}}}{{1.04 \, \text{kg}}} \][/tex]

[tex]\[ m = \frac{{0.87 \, \text{mol}}}{{1.04 \, \text{kg}}} \][/tex]

[tex]\[ m \approx 0.8365 \, \text{mol/kg} \][/tex]

So, the molality of the 0.87 M NaOH solution is approximately [tex]\(0.8365 \, \text{mol/kg}\).[/tex]

(c) 5.24 M NaHCO3 solution:

Given:

- Molarity (\(M\)) of NaHCO3 solution = 5.24 M

- Density of solution = 1.19 g/ml

Let's follow the same steps as above to calculate the molality for the NaHCO3 solution.

For the 5.24 M NaHCO3 solution:

1. Calculate the mass of 1 L (1000 ml) of solution:

[tex]\[ \text{mass of solution} = \text{density} \times \text{volume} \][/tex]

[tex]\[ \text{mass of solution} = 1.19 \, \text{g/ml} \times 1000 \, \text{ml} \][/tex]

[tex]\[ \text{mass of solution} = 1190 \, \text{g} \][/tex]

2. Convert the mass of the solution to kilograms:

[tex]\[ \text{mass of solution in kg} = \frac{{1190 \, \text{g}}}{{1000}} = 1.19 \, \text{kg} \][/tex]

3. Calculate the moles of NaHCO3:

[tex]\[ \text{moles of NaHCO3} = \text{Molarity} \times \text{volume in L} \][/tex]

[tex]\[ \text{moles of NaHCO3} = 5.24 \, \text{mol/L} \times 1 \, \text{L} = 5.24 \, \text{mol} \][/tex]

4. Calculate the molality (\(m\)):

[tex]\[ m = \frac{{\text{moles of NaHCO3}}}{{\text{mass of solvent in kg}}} \][/tex]

[tex]\[ m = \frac{{5.24 \, \text{mol}}}{{1.19 \, \text{kg}}} \][/tex]

[tex]\[ m = \frac{{5.24 \, \text{mol}}}{{1.19 \, \text{kg}}} \][/tex]

[tex]\[ m \approx 4.4034 \, \text{mol/kg} \][/tex]

So, the molality of the 5.24 M NaHCO3 solution is approximately [tex]\(4.4034 \, \text{mol/kg}\).[/tex]

Answer: The wavelength of the absorbed light is 415 nm or [tex]4150\AA[/tex]

Explanation:

To calculate the wavelength of light, we use the equation:

[tex]\lambda=\frac{c}{\nu}[/tex]

where,

[tex]\lambda[/tex] = wavelength of the light  

c = speed of light = [tex]3\times 10^8m/s[/tex]

[tex]\nu[/tex] = frequency of light = [tex]7.23\times 10^{14}Hz=7.23\times 10^{14}s^{-1}[/tex]

Putting the values in above equation, we get:

[tex]\lambda=\frac{3\times 10^8m/s}{7.23\times 10^{14}s^{-1}}=4.15\times 10^{-7}m[/tex]

Converting this into nanometers, we use the conversion factor:

[tex]1m=10^9nm[/tex]

So, [tex]4.15\times 10^{-7}m\times (\frac{10^9nm}{1m})=415nm[/tex]

Converting this into angstroms, we use the conversion factor:

[tex]1m=10^{10}\AA[/tex]

So, [tex]4.15\times 10^{-7}m\times (\frac{10^{10}\AA}{1m})=4150\AA[/tex]

Hence, the wavelength of the absorbed light is 415 nm or [tex]4150\AA[/tex]

The absorbed light that gives some diamonds a yellow color has a wavelength of 415 nm, or 4150 Å, calculated using the speed of light and the given frequency.

The color of light, such as that absorbed by a diamond, is determined by its wavelength. Given the frequency, we can calculate the wavelength using the formula c = λv, where 'c' is the speed of light (3.00 x 10^8 m/s), 'λ' is the wavelength, and 'v' is the frequency.

In this case, the frequency 'v' is given as 7.23 x 10^14 Hz, so we solve for 'λ' to get: λ = c/v = (3.00 x 10^8 m/s) / (7.23 x 10^14 Hz) = 4.15 x 10^-7 m. Converting this to nm (nanometers) and Å (angstroms) gives us 415 nm and 4150 Å, respectively.

https://brainly.com/question/33569910

#SPJ3

Answer: the rate of the reaction will increase.

Explanation: when the concentration of a reaction is increased, this will increase the effective collisions of reactants which in turn increases the rate of the reaction

Doubling the concentration of both reactants A and B in the rate equation rate = k[A][B], which is first order with respect to each reactant, will quadruple the reaction rate. This is a characteristic of second-order reactions.

The student is asking about the effect on the reaction rate when concentrations of reactants in a given rate equation are altered. In the scenario where A reacts with B to give C and D, described by the rate equation rate = k[A][B], if the concentration of both A and B is doubled, the reaction rate will change. This is because the given reaction is first order with respect to both A and B, meaning it is a second-order reaction overall.

If you double the concentration of A to 2[A], the rate equation becomes k(2[A])[B], thereby doubling the reaction rate. Similarly, if B's concentration is also doubled to 2[B], the rate equation now reads k(2[A])(2[B]), which means you multiply the initial rate by four. Thus, doubling the concentrations of both A and B will quadruple the reaction rate due to the multiplicative effect in the rate law.

Remember, rate laws are determined experimentally, and in experiments comparing different trials, doubling the concentration often leads to a reaction rate that is proportional to that change. This reflects a direct relationship between reactant concentrations and reaction rates, as observed in first-order reactions for each reactant.

https://brainly.com/question/13440548

#SPJ6

Answer:

The order of the energy of the photons of given wave will be

= Ultraviolet waves > infrared waves > microwaves

Explanation:

[tex]E=h\nu =\frac{h\times c}{\lambda}[/tex]

where,

E = energy of photon

[tex]\nu [/tex] = frequency of the radiation

h = Planck's constant = [tex]6.63\times 10^{-34}Js[/tex]

c = speed of light = [tex]3\times 10^8m/s[/tex]

[tex]\lambda[/tex] = wavelength of the radiation

We have :

(a) Frequency of infrared waves = [tex]\nu _1=6.5\times 10^{13} s^{-1}[/tex]

(b) Frequency of microwaves= [tex]\nu _2=9.8\times 10^{11} s^{-1}[/tex]

(c) Frequency of ultraviolet waves = [tex]\nu _3=8.0\times 10^{15} s^{-1}[/tex]

So, the decreasing order of the frequencies of the waves  will be :

[tex]\nu _3> \nu _1> \nu _2[/tex]

As we can see from the formula that energy is directly proportional to the frequency of the wave.

[tex]E\propto \nu [/tex]

So, the order of the energy of the photons of given wave will be same as their order of frequencies:

[tex]E_3>E_1>E_2[/tex]

= Ultraviolet waves > infrared waves > microwaves

Answer:

Room B contains the greater mass of air

Explanation:

According to the given data, the volume of both rooms is the same, so let's consider both volumes as V. An open door connects both the room, which infer that pressure for both the rooms is also the same, let it be P.

Considering the above conditions, the general gas equation for the air in both rooms can be given as:

[tex]PV=n_{A}RT_{A}\\ \\ PV=n_{B}RT_{B}[/tex]

Here, n represents the moles of air, R is the gas constant, and T is the temperature. Taking the ratio of both the above equations we get

[tex]\frac{PV}{PV}= \frac{n_{A}RT_{A}}{n_{B}RT_{B}}\\[/tex]

moles of the gas are mass per molecular mass, as the molecular mass is the same in both the cases so n can be replaced by m, as follows

[tex]\frac{PV}{PV}= \frac{m_{A}RT_{A}}{m_{B}RT_{B}}\\[/tex]

By simplifying we get,

[tex]\frac{m_{A}}{m_{B}}=\frac{T_{B}}{T_{A}}[/tex]

According to the given conditions, TA is greater than TB. So from the derived relation, it can be seen that the mass of air in room B is greater than the mass of air in room A.

Answer:

Aragonite is most likely be formed under high pressure.

Explanation:

Relating the densities of Aragonite and Calcite which both has the same chemical composition, it shows that the density of Aragonite is more than Calcite which says to some large extent that there is every possibility that Aragonite is most likely to be formed under high pressure.

Answer:

The wavelength in m = 3.208 m

The wavelength in nm =[tex]3.208\times 10^9 nm[/tex]

The wavelength in Å = [tex]3.208\times 10^{10} \AA[/tex]

Explanation:

To calculate the wavelength of light, we use the equation:

[tex]\lambda=\frac{c}{\nu}[/tex]

where,

[tex]\lambda[/tex] = wavelength of the radiation

c = speed of light = [tex]3.0\times 10^8m/s[/tex]

[tex]\nu[/tex] = frequency of wave

We have :

Frequency of the wave = [tex]\nu =93.5MHz=93.5\times 10^6 Hz[/tex]

[tex]1 Hz = 1s^{-1}[/tex]

Wavelength of the wave = [tex]\lambda [/tex]

[tex]\lambda =\frac{c}{\nu}[/tex]

[tex]\lambda=\frac{3\times 10^8 m/s}{93.5\times 10^6 s^{-1}}=3.208 m[/tex]

[tex]1 m = 10^9 nm[/tex]

[tex]3.208 m= 3.208\times 10^9 nm[/tex]

[tex]1 m = 10^{10} \AA[/tex]

[tex]3.2086 m= 3.208\times 10^{10} \AA[/tex]

The wavelength in m = 3.208 m

The wavelength in nm =[tex]3.208\times 10^9 nm[/tex]

The wavelength in Å = [tex]3.208\times 10^{10} \AA[/tex]

The wavelength in m = 3.208 m

The wavelength in nm = [tex]3.208*10^9 nm[/tex]

The wavelength in Å = [tex]3.208*10^{10}[/tex] Å

It is equal to the speed (v) of a wave train in a medium divided by its frequency (f). It is given by:

[tex]\lambda=\frac{c}{f}[/tex]

where,

[tex]\lambda[/tex] = wavelength of the radiation

c = speed of light = [tex]3.0*10^8m/s[/tex]

f = frequency of wave = 93.5 MHz = [tex]93.5*10^6Hz[/tex]

Calculation of wavelength:

[tex]\lambda=\frac{c}{f}\\\\\lambda=\frac{3.0*10^8m/s}{93.5*10^6s^{-1}} \\\\\lambda=3.208m=3.208*10^9nm=3.208*10^{10}[/tex]Å.

Thus, The value for wavelength in different units are:

The wavelength in m = 3.208 m

The wavelength in nm = [tex]3.208*10^9 nm[/tex]

The wavelength in Å = [tex]3.208*10^{10}[/tex] Å

Find more information about Wavelength here:

brainly.com/question/10728818

Explanation:

A.

The first student will be on the lower bunk on the first floor because 1. They want on the lowest available floor and 2. They want to be in a lower bunk if available.

B.

7 students are in the TOP bunks because 1. They want on the lowest available floor and 2. They want to be in a lower bunk if available. Therefore, all the rooms up till the third floor (Remember, third floor has 3 suites), so the first floor is filled - 1 person on the top bunk, 2 floor is filled- 4 persons and the third floor; the first suite is filled - 1 person and the second suite is a little partially filled- 1 person.

C.

Following the criteria 1, 2 and 3, the 21st student occupies the third suite on the third floor because all the floors (1 and 2) are occupied so the third suite on the third floor is still vacant.

D.

From the criteria there are therefore 10 persons at the TOP bunk. All the rooms up till the third floor are filled, so the first floor is filled - 1 person on the top bunk, second floor is filled (2 suites) - 4 persons and the third floor; the first suite and second suite is filled - 4 persons; the thirs suite has 6 persons present so 1 person is at the top bunk.

Answer:

Same within the groups...

Different within the periods...

Explanation:

The outer configuration is same with a group because of their arrangement in the periodic table. If we see group 1a of alkalies, all of them have 1 electron in their outer shell and this order goes on increasing  up-to noble gases that have 8 electrons in their outer shell each.

This arrangement is called periodicity of the periodic table and elements are arranged according to the periodic law.

Along a period, these properties of outer configuration goes on increasing than within the group.

Final answer:

To find the volume of a platinum sample with a mass of 11.2 g, divide the mass by the density of platinum, which is 21.45 g/cm3, resulting in a volume of approximately 0.5221 [tex]cm^3[/tex].

Explanation:

To determine the volume of a platinum sample with a mass of 11.2 g, given the density of platinum is 21.45 g/cm3, we can use the formula for density which is:

Density = Mass / Volume.

By rearranging the formula to solve for volume, we get:

Volume = Mass / Density.

Substituting the given values:

Volume = 11.2 g / 21.45 g/cm3 = 0.5221  [tex]cm^3[/tex].

Therefore, the volume of the platinum sample is approximately 0.5221  [tex]cm^3[/tex].